C16H11BrN2O3 — CID 2516937
[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl benzoate (PubChem CID 2516937) has the molecular formula C16H11BrN2O3 and a molecular weight of 359.18 g/mol. Its IUPAC name is [5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl benzoate.
| Compound Name | [5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 2516937 |
| Molecular Formula | C16H11BrN2O3 |
| Molecular Weight | 359.18 g/mol |
| Exact Mass | 358.00 |
| IUPAC Name | [5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl benzoate |
| SMILES | O=C(OCc1nnc(-c2ccccc2Br)o1)c1ccccc1 |
| InChI | InChI=1S/C16H11BrN2O3/c17-13-9-5-4-8-12(13)15-19-18-14(22-15)10-21-16(20)11-6-2-1-3-7-11/h1-9H,10H2 |
| InChIKey | NXJJRQSNYSARAW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.18 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |