C14H8BrN3O5S — CID 2613317
[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl 5-nitrothiophene-2-carboxylate (PubChem CID 2613317) has the molecular formula C14H8BrN3O5S and a molecular weight of 410.21 g/mol. Its IUPAC name is [5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl 5-nitrothiophene-2-carboxylate.
| Compound Name | [5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl 5-nitrothiophene-2-carboxylate |
|---|---|
| PubChem CID | 2613317 |
| Molecular Formula | C14H8BrN3O5S |
| Molecular Weight | 410.21 g/mol |
| Exact Mass | 408.94 |
| IUPAC Name | [5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl 5-nitrothiophene-2-carboxylate |
| SMILES | O=C(OCc1nnc(-c2ccccc2Br)o1)c1ccc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C14H8BrN3O5S/c15-9-4-2-1-3-8(9)13-17-16-11(23-13)7-22-14(19)10-5-6-12(24-10)18(20)21/h1-6H,7H2 |
| InChIKey | URYZZJUHZGYWRX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 108.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.21 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|