C10H9ClN2OS — CID 82159367
2-[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]ethanethiol (PubChem CID 82159367) has the molecular formula C10H9ClN2OS and a molecular weight of 240.72 g/mol. Its IUPAC name is 2-[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]ethanethiol.
| Compound Name | 2-[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]ethanethiol |
|---|---|
| PubChem CID | 82159367 |
| Molecular Formula | C10H9ClN2OS |
| Molecular Weight | 240.72 g/mol |
| Exact Mass | 240.01 |
| IUPAC Name | 2-[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]ethanethiol |
| SMILES | SCCc1nnc(-c2ccccc2Cl)o1 |
| InChI | InChI=1S/C10H9ClN2OS/c11-8-4-2-1-3-7(8)10-13-12-9(14-10)5-6-15/h1-4,15H,5-6H2 |
| InChIKey | APHCHZROBAMBNQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 38.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.72 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|