C17H8Cl3N3O3 — CID 43052720
5,6-dichloro-2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]isoindole-1,3-dione (PubChem CID 43052720) has the molecular formula C17H8Cl3N3O3 and a molecular weight of 408.63 g/mol. Its IUPAC name is 5,6-dichloro-2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]isoindole-1,3-dione.
| Compound Name | 5,6-dichloro-2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 43052720 |
| Molecular Formula | C17H8Cl3N3O3 |
| Molecular Weight | 408.63 g/mol |
| Exact Mass | 406.96 |
| IUPAC Name | 5,6-dichloro-2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2cc(Cl)c(Cl)cc2C(=O)N1Cc1nnc(-c2ccccc2Cl)o1 |
| InChI | InChI=1S/C17H8Cl3N3O3/c18-11-4-2-1-3-8(11)15-22-21-14(26-15)7-23-16(24)9-5-12(19)13(20)6-10(9)17(23)25/h1-6H,7H2 |
| InChIKey | PZPWMFGTFQLTBO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.63 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|