C17H9Cl2N3O3 — CID 18870510
5-chloro-1-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]indole-2,3-dione (PubChem CID 18870510) has the molecular formula C17H9Cl2N3O3 and a molecular weight of 374.18 g/mol. Its IUPAC name is 5-chloro-1-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]indole-2,3-dione.
| Compound Name | 5-chloro-1-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 18870510 |
| Molecular Formula | C17H9Cl2N3O3 |
| Molecular Weight | 374.18 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | 5-chloro-1-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]indole-2,3-dione |
| SMILES | O=C1C(=O)N(Cc2nnc(-c3ccccc3Cl)o2)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C17H9Cl2N3O3/c18-9-5-6-13-11(7-9)15(23)17(24)22(13)8-14-20-21-16(25-14)10-3-1-2-4-12(10)19/h1-7H,8H2 |
| InChIKey | RSIBZHCYLFVIRG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.18 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|