C17H14Cl3N3O — CID 110652158
N-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-2-(2,4-dichlorophenyl)ethanamine (PubChem CID 110652158) has the molecular formula C17H14Cl3N3O and a molecular weight of 382.68 g/mol. Its IUPAC name is N-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-2-(2,4-dichlorophenyl)ethanamine.
| Compound Name | N-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-2-(2,4-dichlorophenyl)ethanamine |
|---|---|
| PubChem CID | 110652158 |
| Molecular Formula | C17H14Cl3N3O |
| Molecular Weight | 382.68 g/mol |
| Exact Mass | 381.02 |
| IUPAC Name | N-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-2-(2,4-dichlorophenyl)ethanamine |
| SMILES | Clc1ccc(CCNCc2nnc(-c3ccccc3Cl)o2)c(Cl)c1 |
| InChI | InChI=1S/C17H14Cl3N3O/c18-12-6-5-11(15(20)9-12)7-8-21-10-16-22-23-17(24-16)13-3-1-2-4-14(13)19/h1-6,9,21H,7-8,10H2 |
| InChIKey | INHMEVYBBOMBAG-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.68 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|