C15H9ClF3N3O — CID 75380564
N-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-3,4,5-trifluoroaniline (PubChem CID 75380564) has the molecular formula C15H9ClF3N3O and a molecular weight of 339.70 g/mol. Its IUPAC name is N-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-3,4,5-trifluoroaniline.
| Compound Name | N-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-3,4,5-trifluoroaniline |
|---|---|
| PubChem CID | 75380564 |
| Molecular Formula | C15H9ClF3N3O |
| Molecular Weight | 339.70 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | N-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-3,4,5-trifluoroaniline |
| SMILES | Fc1cc(NCc2nnc(-c3ccccc3Cl)o2)cc(F)c1F |
| InChI | InChI=1S/C15H9ClF3N3O/c16-10-4-2-1-3-9(10)15-22-21-13(23-15)7-20-8-5-11(17)14(19)12(18)6-8/h1-6,20H,7H2 |
| InChIKey | IBRKRZIQALVYLK-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.70 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|