C10H9ClFN3O — CID 106956485
5-(chloromethyl)-N-(4-fluoro-2-methylphenyl)-1,3,4-oxadiazol-2-amine (PubChem CID 106956485) has the molecular formula C10H9ClFN3O and a molecular weight of 241.65 g/mol. Its IUPAC name is 5-(chloromethyl)-N-(4-fluoro-2-methylphenyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(chloromethyl)-N-(4-fluoro-2-methylphenyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106956485 |
| Molecular Formula | C10H9ClFN3O |
| Molecular Weight | 241.65 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | 5-(chloromethyl)-N-(4-fluoro-2-methylphenyl)-1,3,4-oxadiazol-2-amine |
| SMILES | Cc1cc(F)ccc1Nc1nnc(CCl)o1 |
| InChI | InChI=1S/C10H9ClFN3O/c1-6-4-7(12)2-3-8(6)13-10-15-14-9(5-11)16-10/h2-4H,5H2,1H3,(H,13,15) |
| InChIKey | LKCKHBGKAGUPSG-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.65 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|