C11H12FIN4O — CID 106962829
5-(ethylaminomethyl)-N-(4-fluoro-2-iodophenyl)-1,3,4-oxadiazol-2-amine (PubChem CID 106962829) has the molecular formula C11H12FIN4O and a molecular weight of 362.15 g/mol. Its IUPAC name is 5-(ethylaminomethyl)-N-(4-fluoro-2-iodophenyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(ethylaminomethyl)-N-(4-fluoro-2-iodophenyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106962829 |
| Molecular Formula | C11H12FIN4O |
| Molecular Weight | 362.15 g/mol |
| Exact Mass | 362.00 |
| IUPAC Name | 5-(ethylaminomethyl)-N-(4-fluoro-2-iodophenyl)-1,3,4-oxadiazol-2-amine |
| SMILES | CCNCc1nnc(Nc2ccc(F)cc2I)o1 |
| InChI | InChI=1S/C11H12FIN4O/c1-2-14-6-10-16-17-11(18-10)15-9-4-3-7(12)5-8(9)13/h3-5,14H,2,6H2,1H3,(H,15,17) |
| InChIKey | POVZQSLNFHQLTL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 62.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.15 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|