C10H11IN4O — CID 106967012
N-(2-iodophenyl)-5-(methylaminomethyl)-1,3,4-oxadiazol-2-amine (PubChem CID 106967012) has the molecular formula C10H11IN4O and a molecular weight of 330.13 g/mol. Its IUPAC name is N-(2-iodophenyl)-5-(methylaminomethyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | N-(2-iodophenyl)-5-(methylaminomethyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106967012 |
| Molecular Formula | C10H11IN4O |
| Molecular Weight | 330.13 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | N-(2-iodophenyl)-5-(methylaminomethyl)-1,3,4-oxadiazol-2-amine |
| SMILES | CNCc1nnc(Nc2ccccc2I)o1 |
| InChI | InChI=1S/C10H11IN4O/c1-12-6-9-14-15-10(16-9)13-8-5-3-2-4-7(8)11/h2-5,12H,6H2,1H3,(H,13,15) |
| InChIKey | YEOUBPMNVRWZNK-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 62.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.13 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|