C12H14BrFN4O — CID 106968419
N-(2-bromo-4-fluorophenyl)-5-(propylaminomethyl)-1,3,4-oxadiazol-2-amine (PubChem CID 106968419) has the molecular formula C12H14BrFN4O and a molecular weight of 329.17 g/mol. Its IUPAC name is N-(2-bromo-4-fluorophenyl)-5-(propylaminomethyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | N-(2-bromo-4-fluorophenyl)-5-(propylaminomethyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106968419 |
| Molecular Formula | C12H14BrFN4O |
| Molecular Weight | 329.17 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | N-(2-bromo-4-fluorophenyl)-5-(propylaminomethyl)-1,3,4-oxadiazol-2-amine |
| SMILES | CCCNCc1nnc(Nc2ccc(F)cc2Br)o1 |
| InChI | InChI=1S/C12H14BrFN4O/c1-2-5-15-7-11-17-18-12(19-11)16-10-4-3-8(14)6-9(10)13/h3-4,6,15H,2,5,7H2,1H3,(H,16,18) |
| InChIKey | UERCJZGOEBXKSN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 62.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.17 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|