C12H13BrF2N4O — CID 107608662
N-(4-bromo-2,5-difluorophenyl)-5-(propylaminomethyl)-1,3,4-oxadiazol-2-amine (PubChem CID 107608662) has the molecular formula C12H13BrF2N4O and a molecular weight of 347.16 g/mol. Its IUPAC name is N-(4-bromo-2,5-difluorophenyl)-5-(propylaminomethyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | N-(4-bromo-2,5-difluorophenyl)-5-(propylaminomethyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 107608662 |
| Molecular Formula | C12H13BrF2N4O |
| Molecular Weight | 347.16 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | N-(4-bromo-2,5-difluorophenyl)-5-(propylaminomethyl)-1,3,4-oxadiazol-2-amine |
| SMILES | CCCNCc1nnc(Nc2cc(F)c(Br)cc2F)o1 |
| InChI | InChI=1S/C12H13BrF2N4O/c1-2-3-16-6-11-18-19-12(20-11)17-10-5-8(14)7(13)4-9(10)15/h4-5,16H,2-3,6H2,1H3,(H,17,19) |
| InChIKey | YORQXGOHYZLXGZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 62.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.16 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|