C13H17BrN4O — CID 106963881
N-(2-bromo-5-methylphenyl)-5-(propylaminomethyl)-1,3,4-oxadiazol-2-amine (PubChem CID 106963881) has the molecular formula C13H17BrN4O and a molecular weight of 325.21 g/mol. Its IUPAC name is N-(2-bromo-5-methylphenyl)-5-(propylaminomethyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | N-(2-bromo-5-methylphenyl)-5-(propylaminomethyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106963881 |
| Molecular Formula | C13H17BrN4O |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | N-(2-bromo-5-methylphenyl)-5-(propylaminomethyl)-1,3,4-oxadiazol-2-amine |
| SMILES | CCCNCc1nnc(Nc2cc(C)ccc2Br)o1 |
| InChI | InChI=1S/C13H17BrN4O/c1-3-6-15-8-12-17-18-13(19-12)16-11-7-9(2)4-5-10(11)14/h4-5,7,15H,3,6,8H2,1-2H3,(H,16,18) |
| InChIKey | FQPHYLQAURHZGH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 62.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|