C10H10FIN4O — CID 106962819
5-(2-aminoethyl)-N-(4-fluoro-2-iodophenyl)-1,3,4-oxadiazol-2-amine (PubChem CID 106962819) has the molecular formula C10H10FIN4O and a molecular weight of 348.12 g/mol. Its IUPAC name is 5-(2-aminoethyl)-N-(4-fluoro-2-iodophenyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(2-aminoethyl)-N-(4-fluoro-2-iodophenyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106962819 |
| Molecular Formula | C10H10FIN4O |
| Molecular Weight | 348.12 g/mol |
| Exact Mass | 347.99 |
| IUPAC Name | 5-(2-aminoethyl)-N-(4-fluoro-2-iodophenyl)-1,3,4-oxadiazol-2-amine |
| SMILES | NCCc1nnc(Nc2ccc(F)cc2I)o1 |
| InChI | InChI=1S/C10H10FIN4O/c11-6-1-2-8(7(12)5-6)14-10-16-15-9(17-10)3-4-13/h1-2,5H,3-4,13H2,(H,14,16) |
| InChIKey | ICZCXYOORGOPPU-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.12 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|