C10H10N2O2 — CID 122382997
3-methyl-4-(4-methylphenyl)-2-oxido-1,2,5-oxadiazol-2-ium (PubChem CID 122382997) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is 3-methyl-4-(4-methylphenyl)-2-oxido-1,2,5-oxadiazol-2-ium.
| Compound Name | 3-methyl-4-(4-methylphenyl)-2-oxido-1,2,5-oxadiazol-2-ium |
|---|---|
| PubChem CID | 122382997 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 3-methyl-4-(4-methylphenyl)-2-oxido-1,2,5-oxadiazol-2-ium |
| SMILES | Cc1ccc(-c2no[n+]([O-])c2C)cc1 |
| InChI | InChI=1S/C10H10N2O2/c1-7-3-5-9(6-4-7)10-8(2)12(13)14-11-10/h3-6H,1-2H3 |
| InChIKey | WUMCSVVNLVHCTP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 52.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|