C15H14N2O2 — CID 102441723
4-naphthalen-2-yl-2-oxido-3-propan-2-yl-1,2,5-oxadiazol-2-ium (PubChem CID 102441723) has the molecular formula C15H14N2O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is 4-naphthalen-2-yl-2-oxido-3-propan-2-yl-1,2,5-oxadiazol-2-ium.
| Compound Name | 4-naphthalen-2-yl-2-oxido-3-propan-2-yl-1,2,5-oxadiazol-2-ium |
|---|---|
| PubChem CID | 102441723 |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 4-naphthalen-2-yl-2-oxido-3-propan-2-yl-1,2,5-oxadiazol-2-ium |
| SMILES | CC(C)c1c(-c2ccc3ccccc3c2)no[n+]1[O-] |
| InChI | InChI=1S/C15H14N2O2/c1-10(2)15-14(16-19-17(15)18)13-8-7-11-5-3-4-6-12(11)9-13/h3-10H,1-2H3 |
| InChIKey | CRGFMAQGVRBRFN-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 52.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|