C8H5ClN2O2 — CID 13172309
3-chloro-2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium (PubChem CID 13172309) has the molecular formula C8H5ClN2O2 and a molecular weight of 196.59 g/mol. Its IUPAC name is 3-chloro-2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium.
| Compound Name | 3-chloro-2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium |
|---|---|
| PubChem CID | 13172309 |
| Molecular Formula | C8H5ClN2O2 |
| Molecular Weight | 196.59 g/mol |
| Exact Mass | 196.00 |
| IUPAC Name | 3-chloro-2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium |
| SMILES | [O-][n+]1onc(-c2ccccc2)c1Cl |
| InChI | InChI=1S/C8H5ClN2O2/c9-8-7(10-13-11(8)12)6-4-2-1-3-5-6/h1-5H |
| InChIKey | AVBKQRBVXWFMPF-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 52.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.59 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|