C11H6ClN3O — CID 58504273
4-chloro-3-phenyl-[1,2]oxazolo[4,5-d]pyridazine (PubChem CID 58504273) has the molecular formula C11H6ClN3O and a molecular weight of 231.64 g/mol. Its IUPAC name is 4-chloro-3-phenyl-[1,2]oxazolo[4,5-d]pyridazine.
| Compound Name | 4-chloro-3-phenyl-[1,2]oxazolo[4,5-d]pyridazine |
|---|---|
| PubChem CID | 58504273 |
| Molecular Formula | C11H6ClN3O |
| Molecular Weight | 231.64 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | 4-chloro-3-phenyl-[1,2]oxazolo[4,5-d]pyridazine |
| SMILES | Clc1nncc2onc(-c3ccccc3)c12 |
| InChI | InChI=1S/C11H6ClN3O/c12-11-9-8(6-13-14-11)16-15-10(9)7-4-2-1-3-5-7/h1-6H |
| InChIKey | NPXGDWCRXLGCAF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.64 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |