C21H13N7O2 — CID 155812661
3-(5,6-dipyridin-2-yl-1,2,4-triazin-3-yl)-2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium (PubChem CID 155812661) has the molecular formula C21H13N7O2 and a molecular weight of 395.38 g/mol. Its IUPAC name is 3-(5,6-dipyridin-2-yl-1,2,4-triazin-3-yl)-2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium.
| Compound Name | 3-(5,6-dipyridin-2-yl-1,2,4-triazin-3-yl)-2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium |
|---|---|
| PubChem CID | 155812661 |
| Molecular Formula | C21H13N7O2 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 3-(5,6-dipyridin-2-yl-1,2,4-triazin-3-yl)-2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium |
| SMILES | [O-][n+]1onc(-c2ccccc2)c1-c1nnc(-c2ccccn2)c(-c2ccccn2)n1 |
| InChI | InChI=1S/C21H13N7O2/c29-28-20(17(27-30-28)14-8-2-1-3-9-14)21-24-18(15-10-4-6-12-22-15)19(25-26-21)16-11-5-7-13-23-16/h1-13H |
| InChIKey | LZWIXBRYMPTPMJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 117.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|