C13H9N3O2 — CID 102106723
4-oxido-3-phenyl-5-pyridin-2-yl-1,2,4-oxadiazol-4-ium (PubChem CID 102106723) has the molecular formula C13H9N3O2 and a molecular weight of 239.23 g/mol. Its IUPAC name is 4-oxido-3-phenyl-5-pyridin-2-yl-1,2,4-oxadiazol-4-ium.
| Compound Name | 4-oxido-3-phenyl-5-pyridin-2-yl-1,2,4-oxadiazol-4-ium |
|---|---|
| PubChem CID | 102106723 |
| Molecular Formula | C13H9N3O2 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 4-oxido-3-phenyl-5-pyridin-2-yl-1,2,4-oxadiazol-4-ium |
| SMILES | [O-][n+]1c(-c2ccccc2)noc1-c1ccccn1 |
| InChI | InChI=1S/C13H9N3O2/c17-16-12(10-6-2-1-3-7-10)15-18-13(16)11-8-4-5-9-14-11/h1-9H |
| InChIKey | AWGPMDSNIYCFSC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 65.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|