C32H24N8 — CID 101424910
5,8,13,16-tetrapyridin-2-yl-6,7,14,15-tetrazatricyclo[10.4.0.04,9]hexadeca-1(12),4(9),5,7,13,15-hexaene (PubChem CID 101424910) has the molecular formula C32H24N8 and a molecular weight of 520.60 g/mol. Its IUPAC name is 5,8,13,16-tetrapyridin-2-yl-6,7,14,15-tetrazatricyclo[10.4.0.04,9]hexadeca-1(12),4(9),5,7,13,15-hexaene.
| Compound Name | 5,8,13,16-tetrapyridin-2-yl-6,7,14,15-tetrazatricyclo[10.4.0.04,9]hexadeca-1(12),4(9),5,7,13,15-hexaene |
|---|---|
| PubChem CID | 101424910 |
| Molecular Formula | C32H24N8 |
| Molecular Weight | 520.60 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | 5,8,13,16-tetrapyridin-2-yl-6,7,14,15-tetrazatricyclo[10.4.0.04,9]hexadeca-1(12),4(9),5,7,13,15-hexaene |
| SMILES | c1ccc(-c2nnc(-c3ccccn3)c3c2CCc2c(-c4ccccn4)nnc(-c4ccccn4)c2CC3)nc1 |
| InChI | InChI=1S/C32H24N8/c1-5-17-33-25(9-1)29-21-13-14-23-24(16-15-22(21)30(38-37-29)26-10-2-6-18-34-26)32(28-12-4-8-20-36-28)40-39-31(23)27-11-3-7-19-35-27/h1-12,17-20H,13-16H2 |
| InChIKey | CDHDANSGILJCRW-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.60 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |