C16H10N4O4 — CID 136797982
3,5,6-trioxido-4,7-diphenyl-[1,2,5]oxadiazolo[3,4-d]pyridazine-3,5,6-triium (PubChem CID 136797982) has the molecular formula C16H10N4O4 and a molecular weight of 322.28 g/mol. Its IUPAC name is 3,5,6-trioxido-4,7-diphenyl-[1,2,5]oxadiazolo[3,4-d]pyridazine-3,5,6-triium.
| Compound Name | 3,5,6-trioxido-4,7-diphenyl-[1,2,5]oxadiazolo[3,4-d]pyridazine-3,5,6-triium |
|---|---|
| PubChem CID | 136797982 |
| Molecular Formula | C16H10N4O4 |
| Molecular Weight | 322.28 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 3,5,6-trioxido-4,7-diphenyl-[1,2,5]oxadiazolo[3,4-d]pyridazine-3,5,6-triium |
| SMILES | [O-][n+]1onc2c(-c3ccccc3)[n+]([O-])[n+]([O-])c(-c3ccccc3)c21 |
| InChI | InChI=1S/C16H10N4O4/c21-18-14(11-7-3-1-4-8-11)13-16(20(23)24-17-13)15(19(18)22)12-9-5-2-6-10-12/h1-10H |
| InChIKey | XBRQRBDPZADDFW-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 106.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.28 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|