About 2-(4-nitrophenyl)-4,5-diphenyltriazole
2-(4-nitrophenyl)-4,5-diphenyltriazole (PubChem CID 10246761) has the molecular formula C20H14N4O2
and a molecular weight of 342.36 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-4,5-diphenyltriazole.
Molecular Properties
| Compound Name | 2-(4-nitrophenyl)-4,5-diphenyltriazole |
| PubChem CID | 10246761 |
| Molecular Formula | C20H14N4O2 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 2-(4-nitrophenyl)-4,5-diphenyltriazole |
| SMILES | O=[N+]([O-])c1ccc(-n2nc(-c3ccccc3)c(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C20H14N4O2/c25-24(26)18-13-11-17(12-14-18)23-21-19(15-7-3-1-4-8-15)20(22-23)16-9-5-2-6-10-16/h1-14H |
| InChIKey | RUGFOUVGGNRMBY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 73.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-nitrophenyl)-4,5-diphenyltriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-nitrophenyl)-4,5-diphenyltriazole?
The IUPAC name of 2-(4-nitrophenyl)-4,5-diphenyltriazole (CID 10246761) is 2-(4-nitrophenyl)-4,5-diphenyltriazole.
What is the SMILES notation for 2-(4-nitrophenyl)-4,5-diphenyltriazole?
The canonical SMILES for 2-(4-nitrophenyl)-4,5-diphenyltriazole is O=[N+]([O-])c1ccc(-n2nc(-c3ccccc3)c(-c3ccccc3)n2)cc1.
What is the InChIKey of 2-(4-nitrophenyl)-4,5-diphenyltriazole?
The InChIKey is RUGFOUVGGNRMBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14N4O2/c25-24(26)18-13-11-17(12-14-18)23-21-19(15-7-3-1-4-8-15)20(22-23)16-9-5-2-6-10-16/h1-14H.
What are the key properties of 2-(4-nitrophenyl)-4,5-diphenyltriazole?
2-(4-nitrophenyl)-4,5-diphenyltriazole has a molecular weight of 342.36 g/mol, XLogP of 4.51, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-nitrophenyl)-4,5-diphenyltriazole is sourced from PubChem (CID 10246761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).