About 2-(4-nitrophenyl)-3,5-diphenyltetrazol-2-ium bromide
2-(4-nitrophenyl)-3,5-diphenyltetrazol-2-ium bromide (PubChem CID 2915045) has the molecular formula C19H14BrN5O2
and a molecular weight of 424.26 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-3,5-diphenyltetrazol-2-ium bromide.
Molecular Properties
| Compound Name | 2-(4-nitrophenyl)-3,5-diphenyltetrazol-2-ium bromide |
| PubChem CID | 2915045 |
| Molecular Formula | C19H14BrN5O2 |
| Molecular Weight | 424.26 g/mol |
| Exact Mass | 423.03 |
| IUPAC Name | 2-(4-nitrophenyl)-3,5-diphenyltetrazol-2-ium bromide |
| SMILES | O=[N+]([O-])c1ccc(-[n+]2nc(-c3ccccc3)nn2-c2ccccc2)cc1.[Br-] |
| InChI | InChI=1S/C19H14N5O2.BrH/c25-24(26)18-13-11-17(12-14-18)23-21-19(15-7-3-1-4-8-15)20-22(23)16-9-5-2-6-10-16;/h1-14H;1H/q+1;/p-1 |
| InChIKey | YZNTZOVSEPPILK-UHFFFAOYSA-M |
| XLogP | 0.12 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.26 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-nitrophenyl)-3,5-diphenyltetrazol-2-ium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-nitrophenyl)-3,5-diphenyltetrazol-2-ium bromide?
The IUPAC name of 2-(4-nitrophenyl)-3,5-diphenyltetrazol-2-ium bromide (CID 2915045) is 2-(4-nitrophenyl)-3,5-diphenyltetrazol-2-ium bromide.
What is the SMILES notation for 2-(4-nitrophenyl)-3,5-diphenyltetrazol-2-ium bromide?
The canonical SMILES for 2-(4-nitrophenyl)-3,5-diphenyltetrazol-2-ium bromide is O=[N+]([O-])c1ccc(-[n+]2nc(-c3ccccc3)nn2-c2ccccc2)cc1.[Br-].
What is the InChIKey of 2-(4-nitrophenyl)-3,5-diphenyltetrazol-2-ium bromide?
The InChIKey is YZNTZOVSEPPILK-UHFFFAOYSA-M. The full InChI is InChI=1S/C19H14N5O2.BrH/c25-24(26)18-13-11-17(12-14-18)23-21-19(15-7-3-1-4-8-15)20-22(23)16-9-5-2-6-10-16;/h1-14H;1H/q+1;/p-1.
What are the key properties of 2-(4-nitrophenyl)-3,5-diphenyltetrazol-2-ium bromide?
2-(4-nitrophenyl)-3,5-diphenyltetrazol-2-ium bromide has a molecular weight of 424.26 g/mol, XLogP of 0.12, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-nitrophenyl)-3,5-diphenyltetrazol-2-ium bromide is sourced from PubChem (CID 2915045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).