C19H15ClN4 — CID 9283
2,3,5-triphenyltetrazol-2-ium chloride (PubChem CID 9283) has the molecular formula C19H15ClN4 and a molecular weight of 334.81 g/mol. Its IUPAC name is 2,3,5-triphenyltetrazol-2-ium chloride.
| Compound Name | 2,3,5-triphenyltetrazol-2-ium chloride |
|---|---|
| PubChem CID | 9283 |
| Molecular Formula | C19H15ClN4 |
| Molecular Weight | 334.81 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 2,3,5-triphenyltetrazol-2-ium chloride |
| SMILES | [Cl-].c1ccc(-c2nn(-c3ccccc3)[n+](-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C19H15N4.ClH/c1-4-10-16(11-5-1)19-20-22(17-12-6-2-7-13-17)23(21-19)18-14-8-3-9-15-18;/h1-15H;1H/q+1;/p-1 |
| InChIKey | PKDBCJSWQUOKDO-UHFFFAOYSA-M |
| XLogP | 0.22 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.81 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|