C19H15N4+ — CID 9284
2,3,5-triphenyltetrazol-2-ium (PubChem CID 9284) has the molecular formula C19H15N4+ and a molecular weight of 299.36 g/mol. Its IUPAC name is 2,3,5-triphenyltetrazol-2-ium.
| Compound Name | 2,3,5-triphenyltetrazol-2-ium |
|---|---|
| PubChem CID | 9284 |
| Molecular Formula | C19H15N4+ |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 2,3,5-triphenyltetrazol-2-ium |
| SMILES | c1ccc(-c2nn(-c3ccccc3)[n+](-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C19H15N4/c1-4-10-16(11-5-1)19-20-22(17-12-6-2-7-13-17)23(21-19)18-14-8-3-9-15-18/h1-15H/q+1 |
| InChIKey | LNOBZXNCABUBKK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|