C16H8Cl2N4O2 — CID 623096
4,7-bis(4-chlorophenyl)-3-oxido-[1,2,5]oxadiazolo[3,4-d]pyridazin-3-ium (PubChem CID 623096) has the molecular formula C16H8Cl2N4O2 and a molecular weight of 359.17 g/mol. Its IUPAC name is 4,7-bis(4-chlorophenyl)-3-oxido-[1,2,5]oxadiazolo[3,4-d]pyridazin-3-ium.
| Compound Name | 4,7-bis(4-chlorophenyl)-3-oxido-[1,2,5]oxadiazolo[3,4-d]pyridazin-3-ium |
|---|---|
| PubChem CID | 623096 |
| Molecular Formula | C16H8Cl2N4O2 |
| Molecular Weight | 359.17 g/mol |
| Exact Mass | 358.00 |
| IUPAC Name | 4,7-bis(4-chlorophenyl)-3-oxido-[1,2,5]oxadiazolo[3,4-d]pyridazin-3-ium |
| SMILES | [O-][n+]1onc2c(-c3ccc(Cl)cc3)nnc(-c3ccc(Cl)cc3)c21 |
| InChI | InChI=1S/C16H8Cl2N4O2/c17-11-5-1-9(2-6-11)13-15-16(22(23)24-21-15)14(20-19-13)10-3-7-12(18)8-4-10/h1-8H |
| InChIKey | NMICMWMGWGNBBB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 78.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.17 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|