C16H8N6O6 — CID 11834682
4,7-bis(3-nitrophenyl)-3-oxido-[1,2,5]oxadiazolo[3,4-d]pyridazin-3-ium (PubChem CID 11834682) has the molecular formula C16H8N6O6 and a molecular weight of 380.28 g/mol. Its IUPAC name is 4,7-bis(3-nitrophenyl)-3-oxido-[1,2,5]oxadiazolo[3,4-d]pyridazin-3-ium.
| Compound Name | 4,7-bis(3-nitrophenyl)-3-oxido-[1,2,5]oxadiazolo[3,4-d]pyridazin-3-ium |
|---|---|
| PubChem CID | 11834682 |
| Molecular Formula | C16H8N6O6 |
| Molecular Weight | 380.28 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | 4,7-bis(3-nitrophenyl)-3-oxido-[1,2,5]oxadiazolo[3,4-d]pyridazin-3-ium |
| SMILES | O=[N+]([O-])c1cccc(-c2nnc(-c3cccc([N+](=O)[O-])c3)c3c2no[n+]3[O-])c1 |
| InChI | InChI=1S/C16H8N6O6/c23-20(24)11-5-1-3-9(7-11)13-15-16(22(27)28-19-15)14(18-17-13)10-4-2-6-12(8-10)21(25)26/h1-8H |
| InChIKey | QDJDZBCLHMUXGJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 165.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.28 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|