C8H5N3O4 — CID 134105251
4-(3-nitrophenyl)-2-oxido-1,2,5-oxadiazol-2-ium (PubChem CID 134105251) has the molecular formula C8H5N3O4 and a molecular weight of 207.15 g/mol. Its IUPAC name is 4-(3-nitrophenyl)-2-oxido-1,2,5-oxadiazol-2-ium.
| Compound Name | 4-(3-nitrophenyl)-2-oxido-1,2,5-oxadiazol-2-ium |
|---|---|
| PubChem CID | 134105251 |
| Molecular Formula | C8H5N3O4 |
| Molecular Weight | 207.15 g/mol |
| Exact Mass | 207.03 |
| IUPAC Name | 4-(3-nitrophenyl)-2-oxido-1,2,5-oxadiazol-2-ium |
| SMILES | O=[N+]([O-])c1cccc(-c2c[n+]([O-])on2)c1 |
| InChI | InChI=1S/C8H5N3O4/c12-10-5-8(9-15-10)6-2-1-3-7(4-6)11(13)14/h1-5H |
| InChIKey | LCPDIXZTGGGYDF-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 96.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.15 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|