C14H10N4O2 — CID 2737129
3-oxido-8-phenyl-4,5-dihydro-[1,2,5]oxadiazolo[3,4-f]cinnolin-3-ium (PubChem CID 2737129) has the molecular formula C14H10N4O2 and a molecular weight of 266.26 g/mol. Its IUPAC name is 3-oxido-8-phenyl-4,5-dihydro-[1,2,5]oxadiazolo[3,4-f]cinnolin-3-ium.
| Compound Name | 3-oxido-8-phenyl-4,5-dihydro-[1,2,5]oxadiazolo[3,4-f]cinnolin-3-ium |
|---|---|
| PubChem CID | 2737129 |
| Molecular Formula | C14H10N4O2 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 3-oxido-8-phenyl-4,5-dihydro-[1,2,5]oxadiazolo[3,4-f]cinnolin-3-ium |
| SMILES | [O-][n+]1onc2c1CCc1nnc(-c3ccccc3)cc1-2 |
| InChI | InChI=1S/C14H10N4O2/c19-18-13-7-6-11-10(14(13)17-20-18)8-12(16-15-11)9-4-2-1-3-5-9/h1-5,8H,6-7H2 |
| InChIKey | GFEMPVPBJKWUBS-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 78.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|