C8H7ClN2OS — CID 131047818
2-(chloromethyl)-5-(4-methylthiophen-2-yl)-1,3,4-oxadiazole (PubChem CID 131047818) has the molecular formula C8H7ClN2OS and a molecular weight of 214.68 g/mol. Its IUPAC name is 2-(chloromethyl)-5-(4-methylthiophen-2-yl)-1,3,4-oxadiazole.
| Compound Name | 2-(chloromethyl)-5-(4-methylthiophen-2-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 131047818 |
| Molecular Formula | C8H7ClN2OS |
| Molecular Weight | 214.68 g/mol |
| Exact Mass | 214.00 |
| IUPAC Name | 2-(chloromethyl)-5-(4-methylthiophen-2-yl)-1,3,4-oxadiazole |
| SMILES | Cc1csc(-c2nnc(CCl)o2)c1 |
| InChI | InChI=1S/C8H7ClN2OS/c1-5-2-6(13-4-5)8-11-10-7(3-9)12-8/h2,4H,3H2,1H3 |
| InChIKey | RHFOYNGKQANSEW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.68 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|