C7H5ClN2OS — CID 130778751
2-chloro-5-(4-methylthiophen-2-yl)-1,3,4-oxadiazole (PubChem CID 130778751) has the molecular formula C7H5ClN2OS and a molecular weight of 200.65 g/mol. Its IUPAC name is 2-chloro-5-(4-methylthiophen-2-yl)-1,3,4-oxadiazole.
| Compound Name | 2-chloro-5-(4-methylthiophen-2-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 130778751 |
| Molecular Formula | C7H5ClN2OS |
| Molecular Weight | 200.65 g/mol |
| Exact Mass | 199.98 |
| IUPAC Name | 2-chloro-5-(4-methylthiophen-2-yl)-1,3,4-oxadiazole |
| SMILES | Cc1csc(-c2nnc(Cl)o2)c1 |
| InChI | InChI=1S/C7H5ClN2OS/c1-4-2-5(12-3-4)6-9-10-7(8)11-6/h2-3H,1H3 |
| InChIKey | MJNSTSSMGFJVPP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.65 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |