About 2-chloro-5-(3-methyl-1,2-oxazol-5-yl)-1,3,4-oxadiazole
2-chloro-5-(3-methyl-1,2-oxazol-5-yl)-1,3,4-oxadiazole (PubChem CID 114770814) has the molecular formula C6H4ClN3O2
and a molecular weight of 185.57 g/mol. Its IUPAC name is 2-chloro-5-(3-methyl-1,2-oxazol-5-yl)-1,3,4-oxadiazole.
Analyze 2-chloro-5-(3-methyl-1,2-oxazol-5-yl)-1,3,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-(3-methyl-1,2-oxazol-5-yl)-1,3,4-oxadiazole?
The IUPAC name of 2-chloro-5-(3-methyl-1,2-oxazol-5-yl)-1,3,4-oxadiazole (CID 114770814) is 2-chloro-5-(3-methyl-1,2-oxazol-5-yl)-1,3,4-oxadiazole.
What is the SMILES notation for 2-chloro-5-(3-methyl-1,2-oxazol-5-yl)-1,3,4-oxadiazole?
The canonical SMILES for 2-chloro-5-(3-methyl-1,2-oxazol-5-yl)-1,3,4-oxadiazole is Cc1cc(-c2nnc(Cl)o2)on1.
What is the InChIKey of 2-chloro-5-(3-methyl-1,2-oxazol-5-yl)-1,3,4-oxadiazole?
The InChIKey is MYTOTHGIIQUQCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4ClN3O2/c1-3-2-4(12-10-3)5-8-9-6(7)11-5/h2H,1H3.
What are the key properties of 2-chloro-5-(3-methyl-1,2-oxazol-5-yl)-1,3,4-oxadiazole?
2-chloro-5-(3-methyl-1,2-oxazol-5-yl)-1,3,4-oxadiazole has a molecular weight of 185.57 g/mol, XLogP of 1.69, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-(3-methyl-1,2-oxazol-5-yl)-1,3,4-oxadiazole is sourced from PubChem (CID 114770814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).