C9H10ClN3O2 — CID 103095483
3-(1-chloropropyl)-5-(3-methyl-1,2-oxazol-5-yl)-1,2,4-oxadiazole (PubChem CID 103095483) has the molecular formula C9H10ClN3O2 and a molecular weight of 227.65 g/mol. Its IUPAC name is 3-(1-chloropropyl)-5-(3-methyl-1,2-oxazol-5-yl)-1,2,4-oxadiazole.
| Compound Name | 3-(1-chloropropyl)-5-(3-methyl-1,2-oxazol-5-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 103095483 |
| Molecular Formula | C9H10ClN3O2 |
| Molecular Weight | 227.65 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | 3-(1-chloropropyl)-5-(3-methyl-1,2-oxazol-5-yl)-1,2,4-oxadiazole |
| SMILES | CCC(Cl)c1noc(-c2cc(C)no2)n1 |
| InChI | InChI=1S/C9H10ClN3O2/c1-3-6(10)8-11-9(15-13-8)7-4-5(2)12-14-7/h4,6H,3H2,1-2H3 |
| InChIKey | AUEJJVCMKYTNEP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.65 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|