C8H8ClN3OS — CID 103095688
3-(1-chloropropyl)-5-(1,3-thiazol-4-yl)-1,2,4-oxadiazole (PubChem CID 103095688) has the molecular formula C8H8ClN3OS and a molecular weight of 229.69 g/mol. Its IUPAC name is 3-(1-chloropropyl)-5-(1,3-thiazol-4-yl)-1,2,4-oxadiazole.
| Compound Name | 3-(1-chloropropyl)-5-(1,3-thiazol-4-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 103095688 |
| Molecular Formula | C8H8ClN3OS |
| Molecular Weight | 229.69 g/mol |
| Exact Mass | 229.01 |
| IUPAC Name | 3-(1-chloropropyl)-5-(1,3-thiazol-4-yl)-1,2,4-oxadiazole |
| SMILES | CCC(Cl)c1noc(-c2cscn2)n1 |
| InChI | InChI=1S/C8H8ClN3OS/c1-2-5(9)7-11-8(13-12-7)6-3-14-4-10-6/h3-5H,2H2,1H3 |
| InChIKey | ILTNROJGJBCHFA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.69 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|