C11H9Cl3N2O — CID 103095565
3-(1-chloropropyl)-5-(2,6-dichlorophenyl)-1,2,4-oxadiazole (PubChem CID 103095565) has the molecular formula C11H9Cl3N2O and a molecular weight of 291.56 g/mol. Its IUPAC name is 3-(1-chloropropyl)-5-(2,6-dichlorophenyl)-1,2,4-oxadiazole.
| Compound Name | 3-(1-chloropropyl)-5-(2,6-dichlorophenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 103095565 |
| Molecular Formula | C11H9Cl3N2O |
| Molecular Weight | 291.56 g/mol |
| Exact Mass | 289.98 |
| IUPAC Name | 3-(1-chloropropyl)-5-(2,6-dichlorophenyl)-1,2,4-oxadiazole |
| SMILES | CCC(Cl)c1noc(-c2c(Cl)cccc2Cl)n1 |
| InChI | InChI=1S/C11H9Cl3N2O/c1-2-6(12)10-15-11(17-16-10)9-7(13)4-3-5-8(9)14/h3-6H,2H2,1H3 |
| InChIKey | LZBPNSWXLBMFDH-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.56 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|