C8H7ClN2O2S — CID 81127130
2-(chloromethyl)-5-(4-methoxythiophen-2-yl)-1,3,4-oxadiazole (PubChem CID 81127130) has the molecular formula C8H7ClN2O2S and a molecular weight of 230.68 g/mol. Its IUPAC name is 2-(chloromethyl)-5-(4-methoxythiophen-2-yl)-1,3,4-oxadiazole.
| Compound Name | 2-(chloromethyl)-5-(4-methoxythiophen-2-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 81127130 |
| Molecular Formula | C8H7ClN2O2S |
| Molecular Weight | 230.68 g/mol |
| Exact Mass | 229.99 |
| IUPAC Name | 2-(chloromethyl)-5-(4-methoxythiophen-2-yl)-1,3,4-oxadiazole |
| SMILES | COc1csc(-c2nnc(CCl)o2)c1 |
| InChI | InChI=1S/C8H7ClN2O2S/c1-12-5-2-6(14-4-5)8-11-10-7(3-9)13-8/h2,4H,3H2,1H3 |
| InChIKey | IRYKFALQTUALBS-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.68 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|