C9H9ClN2S2 — CID 130978362
2-(2-chloroethyl)-5-(4-methylthiophen-2-yl)-1,3,4-thiadiazole (PubChem CID 130978362) has the molecular formula C9H9ClN2S2 and a molecular weight of 244.77 g/mol. Its IUPAC name is 2-(2-chloroethyl)-5-(4-methylthiophen-2-yl)-1,3,4-thiadiazole.
| Compound Name | 2-(2-chloroethyl)-5-(4-methylthiophen-2-yl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 130978362 |
| Molecular Formula | C9H9ClN2S2 |
| Molecular Weight | 244.77 g/mol |
| Exact Mass | 243.99 |
| IUPAC Name | 2-(2-chloroethyl)-5-(4-methylthiophen-2-yl)-1,3,4-thiadiazole |
| SMILES | Cc1csc(-c2nnc(CCCl)s2)c1 |
| InChI | InChI=1S/C9H9ClN2S2/c1-6-4-7(13-5-6)9-12-11-8(14-9)2-3-10/h4-5H,2-3H2,1H3 |
| InChIKey | XJTRVSWANRJKHY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.77 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|