C10H8Cl2N2OS — CID 106503495
4-chloro-3-[5-(2-chloroethyl)-1,3,4-thiadiazol-2-yl]phenol (PubChem CID 106503495) has the molecular formula C10H8Cl2N2OS and a molecular weight of 275.16 g/mol. Its IUPAC name is 4-chloro-3-[5-(2-chloroethyl)-1,3,4-thiadiazol-2-yl]phenol.
| Compound Name | 4-chloro-3-[5-(2-chloroethyl)-1,3,4-thiadiazol-2-yl]phenol |
|---|---|
| PubChem CID | 106503495 |
| Molecular Formula | C10H8Cl2N2OS |
| Molecular Weight | 275.16 g/mol |
| Exact Mass | 273.97 |
| IUPAC Name | 4-chloro-3-[5-(2-chloroethyl)-1,3,4-thiadiazol-2-yl]phenol |
| SMILES | Oc1ccc(Cl)c(-c2nnc(CCCl)s2)c1 |
| InChI | InChI=1S/C10H8Cl2N2OS/c11-4-3-9-13-14-10(16-9)7-5-6(15)1-2-8(7)12/h1-2,5,15H,3-4H2 |
| InChIKey | OJGXIIREXQSAEM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.16 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|