C14H18ClN3OS — CID 106503504
4-chloro-3-[5-[3-(propylamino)propyl]-1,3,4-thiadiazol-2-yl]phenol (PubChem CID 106503504) has the molecular formula C14H18ClN3OS and a molecular weight of 311.84 g/mol. Its IUPAC name is 4-chloro-3-[5-[3-(propylamino)propyl]-1,3,4-thiadiazol-2-yl]phenol.
| Compound Name | 4-chloro-3-[5-[3-(propylamino)propyl]-1,3,4-thiadiazol-2-yl]phenol |
|---|---|
| PubChem CID | 106503504 |
| Molecular Formula | C14H18ClN3OS |
| Molecular Weight | 311.84 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 4-chloro-3-[5-[3-(propylamino)propyl]-1,3,4-thiadiazol-2-yl]phenol |
| SMILES | CCCNCCCc1nnc(-c2cc(O)ccc2Cl)s1 |
| InChI | InChI=1S/C14H18ClN3OS/c1-2-7-16-8-3-4-13-17-18-14(20-13)11-9-10(19)5-6-12(11)15/h5-6,9,16,19H,2-4,7-8H2,1H3 |
| InChIKey | TXRAPMCRDQMODB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.84 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|