C11H11Cl2N3S — CID 61036809
5-(2,5-dichlorophenyl)-N-propyl-1,3,4-thiadiazol-2-amine (PubChem CID 61036809) has the molecular formula C11H11Cl2N3S and a molecular weight of 288.20 g/mol. Its IUPAC name is 5-(2,5-dichlorophenyl)-N-propyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(2,5-dichlorophenyl)-N-propyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 61036809 |
| Molecular Formula | C11H11Cl2N3S |
| Molecular Weight | 288.20 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | 5-(2,5-dichlorophenyl)-N-propyl-1,3,4-thiadiazol-2-amine |
| SMILES | CCCNc1nnc(-c2cc(Cl)ccc2Cl)s1 |
| InChI | InChI=1S/C11H11Cl2N3S/c1-2-5-14-11-16-15-10(17-11)8-6-7(12)3-4-9(8)13/h3-4,6H,2,5H2,1H3,(H,14,16) |
| InChIKey | VCPBPJDRNVHXEJ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.20 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |