C12H14ClN3OS — CID 61037923
5-(5-chloro-2-methoxyphenyl)-N-propyl-1,3,4-thiadiazol-2-amine (PubChem CID 61037923) has the molecular formula C12H14ClN3OS and a molecular weight of 283.78 g/mol. Its IUPAC name is 5-(5-chloro-2-methoxyphenyl)-N-propyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(5-chloro-2-methoxyphenyl)-N-propyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 61037923 |
| Molecular Formula | C12H14ClN3OS |
| Molecular Weight | 283.78 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 5-(5-chloro-2-methoxyphenyl)-N-propyl-1,3,4-thiadiazol-2-amine |
| SMILES | CCCNc1nnc(-c2cc(Cl)ccc2OC)s1 |
| InChI | InChI=1S/C12H14ClN3OS/c1-3-6-14-12-16-15-11(18-12)9-7-8(13)4-5-10(9)17-2/h4-5,7H,3,6H2,1-2H3,(H,14,16) |
| InChIKey | PLPRHEKHFYYBGN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.78 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |