C14H17N3S3 — CID 80739251
N-propyl-3-(5-thieno[3,2-b]thiophen-5-yl-1,3,4-thiadiazol-2-yl)propan-1-amine (PubChem CID 80739251) has the molecular formula C14H17N3S3 and a molecular weight of 323.51 g/mol. Its IUPAC name is N-propyl-3-(5-thieno[3,2-b]thiophen-5-yl-1,3,4-thiadiazol-2-yl)propan-1-amine.
| Compound Name | N-propyl-3-(5-thieno[3,2-b]thiophen-5-yl-1,3,4-thiadiazol-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 80739251 |
| Molecular Formula | C14H17N3S3 |
| Molecular Weight | 323.51 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | N-propyl-3-(5-thieno[3,2-b]thiophen-5-yl-1,3,4-thiadiazol-2-yl)propan-1-amine |
| SMILES | CCCNCCCc1nnc(-c2cc3sccc3s2)s1 |
| InChI | InChI=1S/C14H17N3S3/c1-2-6-15-7-3-4-13-16-17-14(20-13)12-9-11-10(19-12)5-8-18-11/h5,8-9,15H,2-4,6-7H2,1H3 |
| InChIKey | NIEWKSANYACXTC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.51 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|