C13H15N3OS2 — CID 80745146
N-ethyl-3-(5-thieno[3,2-b]thiophen-5-yl-1,3,4-oxadiazol-2-yl)propan-1-amine (PubChem CID 80745146) has the molecular formula C13H15N3OS2 and a molecular weight of 293.42 g/mol. Its IUPAC name is N-ethyl-3-(5-thieno[3,2-b]thiophen-5-yl-1,3,4-oxadiazol-2-yl)propan-1-amine.
| Compound Name | N-ethyl-3-(5-thieno[3,2-b]thiophen-5-yl-1,3,4-oxadiazol-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 80745146 |
| Molecular Formula | C13H15N3OS2 |
| Molecular Weight | 293.42 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | N-ethyl-3-(5-thieno[3,2-b]thiophen-5-yl-1,3,4-oxadiazol-2-yl)propan-1-amine |
| SMILES | CCNCCCc1nnc(-c2cc3sccc3s2)o1 |
| InChI | InChI=1S/C13H15N3OS2/c1-2-14-6-3-4-12-15-16-13(17-12)11-8-10-9(19-11)5-7-18-10/h5,7-8,14H,2-4,6H2,1H3 |
| InChIKey | RKGRFZLGXJXZTN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|