C12H18N4S2 — CID 114031492
3-[5-(2-methyl-1,3-thiazol-5-yl)-1,3,4-thiadiazol-2-yl]-N-propylpropan-1-amine (PubChem CID 114031492) has the molecular formula C12H18N4S2 and a molecular weight of 282.44 g/mol. Its IUPAC name is 3-[5-(2-methyl-1,3-thiazol-5-yl)-1,3,4-thiadiazol-2-yl]-N-propylpropan-1-amine.
| Compound Name | 3-[5-(2-methyl-1,3-thiazol-5-yl)-1,3,4-thiadiazol-2-yl]-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 114031492 |
| Molecular Formula | C12H18N4S2 |
| Molecular Weight | 282.44 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 3-[5-(2-methyl-1,3-thiazol-5-yl)-1,3,4-thiadiazol-2-yl]-N-propylpropan-1-amine |
| SMILES | CCCNCCCc1nnc(-c2cnc(C)s2)s1 |
| InChI | InChI=1S/C12H18N4S2/c1-3-6-13-7-4-5-11-15-16-12(18-11)10-8-14-9(2)17-10/h8,13H,3-7H2,1-2H3 |
| InChIKey | JNCJXAYKWSDGEF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|