C10H15F4N3S — CID 113435287
N-propyl-3-[5-(1,1,2,2-tetrafluoroethyl)-1,3,4-thiadiazol-2-yl]propan-1-amine (PubChem CID 113435287) has the molecular formula C10H15F4N3S and a molecular weight of 285.31 g/mol. Its IUPAC name is N-propyl-3-[5-(1,1,2,2-tetrafluoroethyl)-1,3,4-thiadiazol-2-yl]propan-1-amine.
| Compound Name | N-propyl-3-[5-(1,1,2,2-tetrafluoroethyl)-1,3,4-thiadiazol-2-yl]propan-1-amine |
|---|---|
| PubChem CID | 113435287 |
| Molecular Formula | C10H15F4N3S |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | N-propyl-3-[5-(1,1,2,2-tetrafluoroethyl)-1,3,4-thiadiazol-2-yl]propan-1-amine |
| SMILES | CCCNCCCc1nnc(C(F)(F)C(F)F)s1 |
| InChI | InChI=1S/C10H15F4N3S/c1-2-5-15-6-3-4-7-16-17-9(18-7)10(13,14)8(11)12/h8,15H,2-6H2,1H3 |
| InChIKey | LRXWFAAPKIODMW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|