C11H16F5N3S — CID 104633036
2-methyl-N-[3-[5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-thiadiazol-2-yl]propyl]propan-2-amine (PubChem CID 104633036) has the molecular formula C11H16F5N3S and a molecular weight of 317.33 g/mol. Its IUPAC name is 2-methyl-N-[3-[5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-thiadiazol-2-yl]propyl]propan-2-amine.
| Compound Name | 2-methyl-N-[3-[5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-thiadiazol-2-yl]propyl]propan-2-amine |
|---|---|
| PubChem CID | 104633036 |
| Molecular Formula | C11H16F5N3S |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 2-methyl-N-[3-[5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-thiadiazol-2-yl]propyl]propan-2-amine |
| SMILES | CC(C)(C)NCCCc1nnc(C(F)(F)C(F)(F)F)s1 |
| InChI | InChI=1S/C11H16F5N3S/c1-9(2,3)17-6-4-5-7-18-19-8(20-7)10(12,13)11(14,15)16/h17H,4-6H2,1-3H3 |
| InChIKey | NZUBYKHDOKYQFK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|