C7H8F5N3S — CID 104633011
3-[5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-thiadiazol-2-yl]propan-1-amine (PubChem CID 104633011) has the molecular formula C7H8F5N3S and a molecular weight of 261.22 g/mol. Its IUPAC name is 3-[5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-thiadiazol-2-yl]propan-1-amine.
| Compound Name | 3-[5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-thiadiazol-2-yl]propan-1-amine |
|---|---|
| PubChem CID | 104633011 |
| Molecular Formula | C7H8F5N3S |
| Molecular Weight | 261.22 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | 3-[5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-thiadiazol-2-yl]propan-1-amine |
| SMILES | NCCCc1nnc(C(F)(F)C(F)(F)F)s1 |
| InChI | InChI=1S/C7H8F5N3S/c8-6(9,7(10,11)12)5-15-14-4(16-5)2-1-3-13/h1-3,13H2 |
| InChIKey | RAOFSTPUMDPKPF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.22 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|