C6H6F5N3S — CID 104633044
N-methyl-1-[5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-thiadiazol-2-yl]methanamine (PubChem CID 104633044) has the molecular formula C6H6F5N3S and a molecular weight of 247.19 g/mol. Its IUPAC name is N-methyl-1-[5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-thiadiazol-2-yl]methanamine.
| Compound Name | N-methyl-1-[5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-thiadiazol-2-yl]methanamine |
|---|---|
| PubChem CID | 104633044 |
| Molecular Formula | C6H6F5N3S |
| Molecular Weight | 247.19 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | N-methyl-1-[5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-thiadiazol-2-yl]methanamine |
| SMILES | CNCc1nnc(C(F)(F)C(F)(F)F)s1 |
| InChI | InChI=1S/C6H6F5N3S/c1-12-2-3-13-14-4(15-3)5(7,8)6(9,10)11/h12H,2H2,1H3 |
| InChIKey | MQOSRARQVOCVIW-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.19 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|