C14H23F3N2O2S2 — CID 158178293
2-(7-tert-butylsulfonylheptyl)-5-(trifluoromethyl)-1,3,4-thiadiazole (PubChem CID 158178293) has the molecular formula C14H23F3N2O2S2 and a molecular weight of 372.48 g/mol. Its IUPAC name is 2-(7-tert-butylsulfonylheptyl)-5-(trifluoromethyl)-1,3,4-thiadiazole.
| Compound Name | 2-(7-tert-butylsulfonylheptyl)-5-(trifluoromethyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 158178293 |
| Molecular Formula | C14H23F3N2O2S2 |
| Molecular Weight | 372.48 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 2-(7-tert-butylsulfonylheptyl)-5-(trifluoromethyl)-1,3,4-thiadiazole |
| SMILES | CC(C)(C)S(=O)(=O)CCCCCCCc1nnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C14H23F3N2O2S2/c1-13(2,3)23(20,21)10-8-6-4-5-7-9-11-18-19-12(22-11)14(15,16)17/h4-10H2,1-3H3 |
| InChIKey | CTZCKKSCFHFFTE-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.48 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|